CAS 2357105-36-1 appears in our catalog under these names: (S)-2-(2,6-Dioxopiperidin-3-yl)-4-hydroxyisoindoline-1,3-dione, 95%, 95%, (S)-Thalidomide-4-OH, 98.0%, (S)-Thalidomide-4-OH, 98%, (S)-2-(2,6-Dioxopiperidin-3-yl)-4-hydroxyisoindoline-1,3-dione, 95%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 50 mg, 25 mg.
2-[(3S)-2,6-dioxopiperidin-3-yl]-4-hydroxyisoindole-1,3-dione (CAS 2357105-36-1) is a chemical compound with the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. IUPAC name: 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-hydroxyisoindole-1,3-dione. InChIKey: XMPJICVFSDYOEG-ZETCQYMHSA-N.
| Molecular formula | C13H10N2O5 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-hydroxyisoindole-1,3-dione |
| InChIKey | XMPJICVFSDYOEG-ZETCQYMHSA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2C(=O)C3=C(C2=O)C(=CC=C3)O |
Computed by PubChem (NCBI)