CAS 2623103-36-4 is the registry number for 3-(2,6-Dioxopiperidin-3-yl)benzo[d]isoxazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,6-dioxopiperidin-3-yl)-1,2-benzoxazole-5-carboxylic acid (CAS 2623103-36-4) is a chemical compound with the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. IUPAC name: 3-(2,6-dioxopiperidin-3-yl)-1,2-benzoxazole-5-carboxylic acid. InChIKey: DBDSWMCFFATFDO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O5 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 3-(2,6-dioxopiperidin-3-yl)-1,2-benzoxazole-5-carboxylic acid |
| InChIKey | DBDSWMCFFATFDO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NOC3=C2C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)