CAS 172333-29-8 appears in our catalog under these names: (S)-2-(2,6-Dioxopiperidin-3-yl)-5-hydroxyisoindoline-1,3-dione, 98%, (S)-Thalidomide-5-OH. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-[(3S)-2,6-dioxopiperidin-3-yl]-5-hydroxyisoindole-1,3-dione (CAS 172333-29-8) is a chemical compound with the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. IUPAC name: 2-[(3S)-2,6-dioxopiperidin-3-yl]-5-hydroxyisoindole-1,3-dione. InChIKey: LJBQRRQTZUJWRC-VIFPVBQESA-N.
| Molecular formula | C13H10N2O5 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-5-hydroxyisoindole-1,3-dione |
| InChIKey | LJBQRRQTZUJWRC-VIFPVBQESA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2C(=O)C3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)