cas: 1224945-39-4 — see every product listed under this CAS number, including other names
(S)-2-(2-Bromophenyl)pyrrolidine hydrochloride, 97%, 97% (CAS 1224945-39-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DU7I-1g |
| cas | 1224945-39-4 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4374.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(2-bromophenyl)pyrrolidine;hydrochloride (CAS 1224945-39-4) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: (2S)-2-(2-bromophenyl)pyrrolidine;hydrochloride. InChIKey: IWYBONFNXVFTFX-PPHPATTJSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | (2S)-2-(2-bromophenyl)pyrrolidine;hydrochloride |
| InChIKey | IWYBONFNXVFTFX-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC=CC=C2Br.Cl |
Computed by PubChem (NCBI)