CAS 848135-96-6 appears in our catalog under these names: 7-Bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%, 7-Bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 7-Bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
7-bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 848135-96-6) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 7-bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: WRVLUERSOKOVSZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 7-bromo-3-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | WRVLUERSOKOVSZ-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(CN1)C=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)