CAS 1187930-57-9 appears in our catalog under these names: 2-(4-Bromophenyl)pyrrolidine hydrochloride, 96%, 2-(4-bromophenyl)pyrrolidine hcl, 2-(4-Bromophenyl)pyrrolidine hydrochloride 96%, 2-(4-Bromophenyl)pyrrolidine hydrochloride, 96%, 96%, 2-(4-Bromo-phenyl)-pyrrolidine hydrochloride, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2-(4-bromophenyl)pyrrolidine;hydrochloride (CAS 1187930-57-9) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 2-(4-bromophenyl)pyrrolidine;hydrochloride. InChIKey: MFKFCHQDGBJUIU-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 2-(4-bromophenyl)pyrrolidine;hydrochloride |
| InChIKey | MFKFCHQDGBJUIU-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)