(S)-2-(4-Methylphenylsulfonamido)-3-phenylpropanoyl chloride, 97%+, 97%+
cas: 29739-88-6 — see every product listed under this CAS number, including other names
(S)-2-(4-Methylphenylsulfonamido)-3-phenylpropanoyl chloride, 97%+, 97%+ (CAS 29739-88-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Z0A-250mg |
| cas | 29739-88-6 |
| size | 250mg |
| availability | 35g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 794.00 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2661.20 Pln |
properties
| purity | 97%+ |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl chloride (CAS 29739-88-6) is a chemical compound with the molecular formula C16H16ClNO3S and a molecular weight of 337.8 g/mol. IUPAC name: (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl chloride. InChIKey: KISOIDIHUAPEON-HNNXBMFYSA-N.
| Molecular formula | C16H16ClNO3S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl chloride |
| InChIKey | KISOIDIHUAPEON-HNNXBMFYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CC2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
Tosyl-L-phenylalanyl Chloride, N-(p-Toluenesulfonyl)-L-phenylalanyl Chloride, (S)-2-(4-Methylphenylsulfonamido)-3-phenylpropanoyl chloride, (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl chloride, Tosyl-L-phenylalaninoyl chloride, Benzenepropanoyl chloride, alpha-[[(4-methylphenyl)sulfonyl]amino]-, (alphaS)-, Tos-Phe-Cl, s12087, N-(4-Methylbenzene-1-sulfonyl)-L-phenylalanyl chloride, (2S)-3-phenyl-2-(p-tolylsulfonylamino)propanoyl chloride