CAS 29739-88-6 appears in our catalog under these names: N-(p-Toluenesulfonyl)-L-phenylalanyl chloride, 97%, Tosyl–L–phenylalaninoyl chloride, N-(p-Toluenesulfonyl)-L-phenylalanyl Chloride [Optical Resolving Reagent for Alcohols], >97.0%(T), (S)-2-(4-Methylphenylsulfonamido)-3-phenylpropanoyl chloride, 97%+, 97%+. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl chloride (CAS 29739-88-6) is a chemical compound with the molecular formula C16H16ClNO3S and a molecular weight of 337.8 g/mol. IUPAC name: (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl chloride. InChIKey: KISOIDIHUAPEON-HNNXBMFYSA-N.
| Molecular formula | C16H16ClNO3S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | (2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl chloride |
| InChIKey | KISOIDIHUAPEON-HNNXBMFYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CC2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)