CAS 1319197-71-1 appears in our catalog under these names: 5-((S)-1-(2-Chlorophenyl)-2-methoxy-2-oxoethyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine 5-oxide, 95%, Clopidogrel Impurity 51, (S)-Clopidogrel N-Oxide, Clopidogrel 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
Methyl (2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetate (CAS 1319197-71-1) is a chemical compound with the molecular formula C16H16ClNO3S and a molecular weight of 337.8 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetate. InChIKey: GYAQMDGEXWMAFB-BUSXIPJBSA-N.
| Molecular formula | C16H16ClNO3S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetate |
| InChIKey | GYAQMDGEXWMAFB-BUSXIPJBSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)[N+]2(CCC3=C(C2)C=CS3)[O-] |
Computed by PubChem (NCBI)