(S)-2-(Benzo[b]thiophen-2-yl)-4-cyclohexyl-4,5-dihydrooxazole, 97%
cas: 2828438-76-0 — see every product listed under this CAS number, including other names
(S)-2-(Benzo[b]thiophen-2-yl)-4-cyclohexyl-4,5-dihydrooxazole, 97% (CAS 2828438-76-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1519927-250mg |
| cas | 2828438-76-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1772.12 Pln | |
| Ambeed | 5g | 6884.06 Pln | |
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 1g | 1581.20 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 653.13 Pln | |
| BLDpharm | 1g | 1741.63 Pln | |
| BLDpharm | 5g | 6745.43 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-2-(1-benzothiophen-2-yl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole (CAS 2828438-76-0) is a chemical compound with the molecular formula C17H19NOS and a molecular weight of 285.4 g/mol. IUPAC name: (4S)-2-(1-benzothiophen-2-yl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole. InChIKey: AZMKRZALCNPMMD-CQSZACIVSA-N.
| Molecular formula | C17H19NOS |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | (4S)-2-(1-benzothiophen-2-yl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole |
| InChIKey | AZMKRZALCNPMMD-CQSZACIVSA-N |
| SMILES | C1CCC(CC1)[C@H]2COC(=N2)C3=CC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)