Products 1071700-39-4
CAS 1071700-39-4 appears in our catalog under these names: [2-(5A,6,7,8,9,9A-Hexahydro-4h-thieno[3,2-c]chromen-4-yl)phenyl]amine, 95%, 2-(5A,6,7,8,9,9a-hexahydro-4H-thieno(3,2-c)chromen-4-yl)aniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromen-4-yl)aniline (CAS 1071700-39-4) is a chemical compound with the molecular formula C17H19NOS and a molecular weight of 285.4 g/mol. IUPAC name: 2-(5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromen-4-yl)aniline. InChIKey: VBTAIIORPJWNIB-UHFFFAOYSA-N.
| Molecular formula | C17H19NOS |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 2-(5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromen-4-yl)aniline |
| InChIKey | VBTAIIORPJWNIB-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C3=C(C=CS3)C(O2)C4=CC=CC=C4N |
Computed by PubChem (NCBI)