Products 2828438-76-0
CAS 2828438-76-0 is the registry number for (S)-2-(Benzo[b]thiophen-2-yl)-4-cyclohexyl-4,5-dihydrooxazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4S)-2-(1-benzothiophen-2-yl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole (CAS 2828438-76-0) is a chemical compound with the molecular formula C17H19NOS and a molecular weight of 285.4 g/mol. IUPAC name: (4S)-2-(1-benzothiophen-2-yl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole. InChIKey: AZMKRZALCNPMMD-CQSZACIVSA-N.
| Molecular formula | C17H19NOS |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | (4S)-2-(1-benzothiophen-2-yl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole |
| InChIKey | AZMKRZALCNPMMD-CQSZACIVSA-N |
| SMILES | C1CCC(CC1)[C@H]2COC(=N2)C3=CC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)