(S)-2-(Benzo[b]thiophen-2-yl)-4-isobutyl-4,5-dihydrooxazole, 95%
cas: 2828438-78-2 — see every product listed under this CAS number, including other names
(S)-2-(Benzo[b]thiophen-2-yl)-4-isobutyl-4,5-dihydrooxazole, 95% (CAS 2828438-78-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 100mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1519929-250mg |
| cas | 2828438-78-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 5g | 4970.56 Pln | |
| BLDpharm | 100mg | 286.59 Pln | |
| BLDpharm | 250mg | 430.98 Pln | |
| BLDpharm | 1g | 1108.52 Pln | |
| BLDpharm | 5g | 4212.99 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 1197.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-2-(1-benzothiophen-2-yl)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazole (CAS 2828438-78-2) is a chemical compound with the molecular formula C15H17NOS and a molecular weight of 259.4 g/mol. IUPAC name: (4S)-2-(1-benzothiophen-2-yl)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazole. InChIKey: HVZFWIXHCKUXTO-LBPRGKRZSA-N.
| Molecular formula | C15H17NOS |
|---|---|
| Molecular weight | 259.4 g/mol |
| IUPAC name | (4S)-2-(1-benzothiophen-2-yl)-4-(2-methylpropyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | HVZFWIXHCKUXTO-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@H]1COC(=N1)C2=CC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)