CAS 2757084-01-6 appears in our catalog under these names: (R)-2-(Benzo[b]thiophen-2-yl)-4-(tert-butyl)-4,5-dihydrooxazole, 97%, 97%, (R)-2-(Benzo[b]thiophen-2-yl)-4-(tert-butyl)-4,5-dihydrooxazole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4R)-2-(1-benzothiophen-2-yl)-4-tert-butyl-4,5-dihydro-1,3-oxazole (CAS 2757084-01-6) is a chemical compound with the molecular formula C15H17NOS and a molecular weight of 259.4 g/mol. IUPAC name: (4R)-2-(1-benzothiophen-2-yl)-4-tert-butyl-4,5-dihydro-1,3-oxazole. InChIKey: WLPAKSNFHVIZND-ZDUSSCGKSA-N.
| Molecular formula | C15H17NOS |
|---|---|
| Molecular weight | 259.4 g/mol |
| IUPAC name | (4R)-2-(1-benzothiophen-2-yl)-4-tert-butyl-4,5-dihydro-1,3-oxazole |
| InChIKey | WLPAKSNFHVIZND-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)[C@@H]1COC(=N1)C2=CC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)