Products 451503-13-2
CAS 451503-13-2 is the registry number for (R,E)-2-Methyl-N-(naphthalen-1-ylmethylene)propane-2-sulfinamide, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(NE)-2-methyl-N-(naphthalen-1-ylmethylidene)propane-2-sulfinamide (CAS 451503-13-2) is a chemical compound with the molecular formula C15H17NOS and a molecular weight of 259.4 g/mol. IUPAC name: (NE)-2-methyl-N-(naphthalen-1-ylmethylidene)propane-2-sulfinamide. InChIKey: JDDGAGPKEGIXSR-LFIBNONCSA-N.
| Molecular formula | C15H17NOS |
|---|---|
| Molecular weight | 259.4 g/mol |
| IUPAC name | (NE)-2-methyl-N-(naphthalen-1-ylmethylidene)propane-2-sulfinamide |
| InChIKey | JDDGAGPKEGIXSR-LFIBNONCSA-N |
| SMILES | CC(C)(C)S(=O)/N=C/C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)