(S)-2-(Benzo[b]thiophen-2-yl)-4-methyl-4,5-dihydrooxazole, 98%
cas: 2828439-74-1 — see every product listed under this CAS number, including other names
(S)-2-(Benzo[b]thiophen-2-yl)-4-methyl-4,5-dihydrooxazole, 98% (CAS 2828439-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1537654-100mg |
| cas | 2828439-74-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 720.81 Pln | |
| Ambeed | 5g | 2667.69 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 837.20 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 303.25 Pln | |
| BLDpharm | 1g | 769.75 Pln | |
| BLDpharm | 5g | 2869.01 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-2-(1-benzothiophen-2-yl)-4-methyl-4,5-dihydro-1,3-oxazole (CAS 2828439-74-1) is a chemical compound with the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. IUPAC name: (4S)-2-(1-benzothiophen-2-yl)-4-methyl-4,5-dihydro-1,3-oxazole. InChIKey: ZTTLPQXEHADBIG-QMMMGPOBSA-N.
| Molecular formula | C12H11NOS |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | (4S)-2-(1-benzothiophen-2-yl)-4-methyl-4,5-dihydro-1,3-oxazole |
| InChIKey | ZTTLPQXEHADBIG-QMMMGPOBSA-N |
| SMILES | C[C@H]1COC(=N1)C2=CC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)