CAS 284483-04-1 appears in our catalog under these names: (S)-2-(Benzo[h]quinolin-2-yl)-4-(tert-butyl)-4,5-dihydrooxazole, 98%, 98%, (S)-2-(Benzo[h]quinolin-2-yl)-4-(tert-butyl)-4,5-dihydrooxazole, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4S)-2-benzo[h]quinolin-2-yl-4-tert-butyl-4,5-dihydro-1,3-oxazole (CAS 284483-04-1) is a chemical compound with the molecular formula C20H20N2O and a molecular weight of 304.4 g/mol. IUPAC name: (4S)-2-benzo[h]quinolin-2-yl-4-tert-butyl-4,5-dihydro-1,3-oxazole. InChIKey: MFVLXXMHRWVLLT-QGZVFWFLSA-N.
| Molecular formula | C20H20N2O |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (4S)-2-benzo[h]quinolin-2-yl-4-tert-butyl-4,5-dihydro-1,3-oxazole |
| InChIKey | MFVLXXMHRWVLLT-QGZVFWFLSA-N |
| SMILES | CC(C)(C)[C@H]1COC(=N1)C2=NC3=C(C=CC4=CC=CC=C43)C=C2 |
Computed by PubChem (NCBI)