Products 591241-84-8
CAS 591241-84-8 is the registry number for N-(4-(cyanomethyl)phenyl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-(cyanomethyl)phenyl]-1-phenylcyclopentane-1-carboxamide (CAS 591241-84-8) is a chemical compound with the molecular formula C20H20N2O and a molecular weight of 304.4 g/mol. IUPAC name: N-[4-(cyanomethyl)phenyl]-1-phenylcyclopentane-1-carboxamide. InChIKey: LRIYMJABROKOIU-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | N-[4-(cyanomethyl)phenyl]-1-phenylcyclopentane-1-carboxamide |
| InChIKey | LRIYMJABROKOIU-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)CC#N |
Computed by PubChem (NCBI)