CAS 1169705-95-6 is the registry number for 9-(tert-Butyl)-7,12-dihydrobenzo[2,3]azepino[4,5-b]indol-6(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
9-tert-butyl-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one (CAS 1169705-95-6) is a chemical compound with the molecular formula C20H20N2O and a molecular weight of 304.4 g/mol. IUPAC name: 9-tert-butyl-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one. InChIKey: FSBVDCKGYBXQAE-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 9-tert-butyl-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
| InChIKey | FSBVDCKGYBXQAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NC3=C2CC(=O)NC4=CC=CC=C43 |
Computed by PubChem (NCBI)