cas: 1391398-48-3 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(2-bromophenyl)ethanol hydrochloride 95% (CAS 1391398-48-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1192145-250mg |
| cas | 1391398-48-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 2089.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1192145 |
(2S)-2-amino-2-(2-bromophenyl)ethanol;hydrochloride (CAS 1391398-48-3) is a chemical compound with the molecular formula C8H11BrClNO and a molecular weight of 252.53 g/mol. IUPAC name: (2S)-2-amino-2-(2-bromophenyl)ethanol;hydrochloride. InChIKey: FHWGMOICMCKSHB-DDWIOCJRSA-N.
| Molecular formula | C8H11BrClNO |
|---|---|
| Molecular weight | 252.53 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-bromophenyl)ethanol;hydrochloride |
| InChIKey | FHWGMOICMCKSHB-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](CO)N)Br.Cl |
Computed by PubChem (NCBI)