CAS 2055576-85-5 appears in our catalog under these names: (S)–2–amino–2–(3–chloro–5–fluorophenyl)ethan–1–ol hcl, (2S)-2-amino-2-(3-chloro-5-fluorophenyl)ethanol hydrochloride, 95%, 95%, (S)-2-amino-2-(3-chloro-5-fluorophenyl)ethan-1-ol hcl, 95%, (S)-2-Amino-2-(3-chloro-5-fluorophenyl)ethan-1-ol hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-2-(3-chloro-5-fluorophenyl)ethanol;hydrochloride (CAS 2055576-85-5) is a chemical compound with the molecular formula C8H10Cl2FNO and a molecular weight of 226.07 g/mol. IUPAC name: (2S)-2-amino-2-(3-chloro-5-fluorophenyl)ethanol;hydrochloride. InChIKey: VKQRLRQTSDDQKY-DDWIOCJRSA-N.
| Molecular formula | C8H10Cl2FNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-chloro-5-fluorophenyl)ethanol;hydrochloride |
| InChIKey | VKQRLRQTSDDQKY-DDWIOCJRSA-N |
| SMILES | C1=C(C=C(C=C1F)Cl)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)