CAS 1391458-54-0 is the registry number for (S)–2–Amino–2–(2–chloro–5–fluorophenyl)ethan–1–ol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2S)-2-amino-2-(2-chloro-5-fluorophenyl)ethanol;hydrochloride (CAS 1391458-54-0) is a chemical compound with the molecular formula C8H10Cl2FNO and a molecular weight of 226.07 g/mol. IUPAC name: (2S)-2-amino-2-(2-chloro-5-fluorophenyl)ethanol;hydrochloride. InChIKey: HTKNOSRTQVJBDP-DDWIOCJRSA-N.
| Molecular formula | C8H10Cl2FNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-chloro-5-fluorophenyl)ethanol;hydrochloride |
| InChIKey | HTKNOSRTQVJBDP-DDWIOCJRSA-N |
| SMILES | C1=CC(=C(C=C1F)[C@@H](CO)N)Cl.Cl |
Computed by PubChem (NCBI)