CAS 1051919-33-5 appears in our catalog under these names: 2-(2-Chloro-4-fluorophenoxy)ethylamine hydrochloride, 95%, 2-(2-Chloro-4-fluorophenoxy)ethanamine hydrochloride, 97%, 2-(2-Chloro-4-fluorophenoxy)ethylaminehydrochloride, 2-(2-Chloro-4-fluorophenoxy)ethylamine hydrochloride, 97%, 97%, 2-(2-Chloro-4-fluorophenoxy)ethylamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,5g, 10g, 25g.
2-(2-chloro-4-fluorophenoxy)ethanamine;hydrochloride (CAS 1051919-33-5) is a chemical compound with the molecular formula C8H10Cl2FNO and a molecular weight of 226.07 g/mol. IUPAC name: 2-(2-chloro-4-fluorophenoxy)ethanamine;hydrochloride. InChIKey: KNCOTHOJVWILSN-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2FNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 2-(2-chloro-4-fluorophenoxy)ethanamine;hydrochloride |
| InChIKey | KNCOTHOJVWILSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)OCCN.Cl |
Computed by PubChem (NCBI)