(S)-2-Amino-2-(4-isopropylphenyl)acetic acid, 95%
cas: 168393-61-1 — see every product listed under this CAS number, including other names
(S)-2-Amino-2-(4-isopropylphenyl)acetic acid, 95% (CAS 168393-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11AS0K-100mg |
| cas | 168393-61-1 |
| size | 100mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1005.20 Pln | |
| Chemat | 1g | 2805.20 Pln | |
| Chemat | 5g | 11027.60 Pln | |
| BLDpharm | 100mg | 669.79 Pln | |
| BLDpharm | 250mg | 1125.18 Pln | |
| BLDpharm | 1g | 3152.25 Pln | |
| BLDpharm | 5g | 12393.44 Pln | |
| Fluorochem | 250mg | 1856.66 Pln | |
| Fluorochem | 1g | 5204.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-2-(4-propan-2-ylphenyl)acetic acid (CAS 168393-61-1) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2S)-2-amino-2-(4-propan-2-ylphenyl)acetic acid. InChIKey: UTHDNBNSZXJSDC-JTQLQIEISA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-propan-2-ylphenyl)acetic acid |
| InChIKey | UTHDNBNSZXJSDC-JTQLQIEISA-N |
| SMILES | CC(C)C1=CC=C(C=C1)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)