CAS 1566022-93-2 appears in our catalog under these names: Methyl 2-amino-2-(2,6-dimethylphenyl)acetate, Methyl 2-amino-2-(2,6-dimethylphenyl)acetate, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 5g, 250mg.
Methyl 2-amino-2-(2,6-dimethylphenyl)acetate (CAS 1566022-93-2) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: methyl 2-amino-2-(2,6-dimethylphenyl)acetate. InChIKey: RYOZHJJAWOSTPE-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | methyl 2-amino-2-(2,6-dimethylphenyl)acetate |
| InChIKey | RYOZHJJAWOSTPE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C(C(=O)OC)N |
Computed by PubChem (NCBI)