CAS 99985-67-8 appears in our catalog under these names: 4-(tert-Butoxy)benzamide, 95%, 4-(tert-Butoxy)benzamide, 95+%, 4-(tert-Butoxy)benzamide, ≥95%, ≥95%, 4-(TERT-BUTOXY)BENZAMIDE, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-[(2-methylpropan-2-yl)oxy]benzamide (CAS 99985-67-8) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxy]benzamide. InChIKey: SWWGCYPSKPHPKQ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxy]benzamide |
| InChIKey | SWWGCYPSKPHPKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C(=O)N |
Computed by PubChem (NCBI)