cas: 2628280-48-6 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-((S)-2-oxopyrrolidin-3-yl)propanamide hydrochloride, 97% (CAS 2628280-48-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F759495-1G |
| cas | 2628280-48-6 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 575.86 Pln | |
| Fluorochem | 25g | 1080.89 Pln | |
| Fluorochem | 100g | 2741.76 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 731.94 Pln | |
| Ambeed | 25g | 1371.62 Pln | |
| Ambeed | 100g | 4247.44 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanamide;hydrochloride (CAS 2628280-48-6) is a chemical compound with the molecular formula C7H14ClN3O2 and a molecular weight of 207.66 g/mol. IUPAC name: (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanamide;hydrochloride. InChIKey: XMKRXOFRYITIKH-FHAQVOQBSA-N.
| Molecular formula | C7H14ClN3O2 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanamide;hydrochloride |
| InChIKey | XMKRXOFRYITIKH-FHAQVOQBSA-N |
| SMILES | C1CNC(=O)[C@@H]1C[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)