Products 1236262-73-9
CAS 1236262-73-9 appears in our catalog under these names: 4-(2-Aminopropanoyl)piperazin-2-one hydrochloride, 95%, 4-(2-Aminopropanoyl)piperazin-2-one hydrochloride, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g.
4-(2-aminopropanoyl)piperazin-2-one;hydrochloride (CAS 1236262-73-9) is a chemical compound with the molecular formula C7H14ClN3O2 and a molecular weight of 207.66 g/mol. IUPAC name: 4-(2-aminopropanoyl)piperazin-2-one;hydrochloride. InChIKey: IEUQQEYLTKWGEI-UHFFFAOYSA-N.
| Molecular formula | C7H14ClN3O2 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | 4-(2-aminopropanoyl)piperazin-2-one;hydrochloride |
| InChIKey | IEUQQEYLTKWGEI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCNC(=O)C1)N.Cl |
Computed by PubChem (NCBI)