Products 2889532-79-8
CAS 2889532-79-8 is the registry number for (R)-2-Amino-3-((R)-2-oxopyrrolidin-3-yl)propanamide Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(2R)-2-amino-3-[(3R)-2-oxopyrrolidin-3-yl]propanamide;hydrochloride (CAS 2889532-79-8) is a chemical compound with the molecular formula C7H14ClN3O2 and a molecular weight of 207.66 g/mol. IUPAC name: (2R)-2-amino-3-[(3R)-2-oxopyrrolidin-3-yl]propanamide;hydrochloride. InChIKey: XMKRXOFRYITIKH-TYSVMGFPSA-N.
| Molecular formula | C7H14ClN3O2 |
|---|---|
| Molecular weight | 207.66 g/mol |
| IUPAC name | (2R)-2-amino-3-[(3R)-2-oxopyrrolidin-3-yl]propanamide;hydrochloride |
| InChIKey | XMKRXOFRYITIKH-TYSVMGFPSA-N |
| SMILES | C1CNC(=O)[C@H]1C[C@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)