cas: 1213206-88-2 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-(4-bromo-2-fluorophenyl)propanoic acid, 97% (CAS 1213206-88-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A869204-1g |
| cas | 1213206-88-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 2524.27 Pln | |
| AmBeed | 5g | 7009.66 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid (CAS 1213206-88-2) is a chemical compound with the molecular formula C9H9BrFNO2 and a molecular weight of 262.08 g/mol. IUPAC name: (2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid. InChIKey: MQJFVIRBPSXVRP-QMMMGPOBSA-N.
| Molecular formula | C9H9BrFNO2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid |
| InChIKey | MQJFVIRBPSXVRP-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)