Products 439587-17-4
CAS 439587-17-4 appears in our catalog under these names: DL-4-Bromo-2-fluoropenylalanine, 95%, 2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid (CAS 439587-17-4) is a chemical compound with the molecular formula C9H9BrFNO2 and a molecular weight of 262.08 g/mol. IUPAC name: 2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid. InChIKey: MQJFVIRBPSXVRP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | 2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid |
| InChIKey | MQJFVIRBPSXVRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)