CAS 1213206-88-2 appears in our catalog under these names: (s)-2-Amino-3-(4-bromo-2-fluorophenyl)propanoic acid, (2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid, 95%, (S)-2-Amino-3-(4-bromo-2-fluorophenyl)propanoic acid, 97%, (s)-2-Amino-3-(4-bromo-2-fluorophenyl)propanoic acid, 97%, 97%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid (CAS 1213206-88-2) is a chemical compound with the molecular formula C9H9BrFNO2 and a molecular weight of 262.08 g/mol. IUPAC name: (2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid. InChIKey: MQJFVIRBPSXVRP-QMMMGPOBSA-N.
| Molecular formula | C9H9BrFNO2 |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-bromo-2-fluorophenyl)propanoic acid |
| InChIKey | MQJFVIRBPSXVRP-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)