cas: 141774-68-7 — see every product listed under this CAS number, including other names
(S)-2-Aminomethyl-1-N-Cbz-pyrrolidine, 98% (CAS 141774-68-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011402-1G |
| cas | 141774-68-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 575.86 Pln | |
| Fluorochem | 25g | 1809.80 Pln | |
| Fluorochem | 100g | 5886.49 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate (CAS 141774-68-7) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate. InChIKey: NQGRCKNDDGCZPV-LBPRGKRZSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl (2S)-2-(aminomethyl)pyrrolidine-1-carboxylate |
| InChIKey | NQGRCKNDDGCZPV-LBPRGKRZSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)CN |
Computed by PubChem (NCBI)