CAS 119020-03-0 appears in our catalog under these names: 2-Aminomethyl-pyrrolidine-1-carboxylic acid benzyl ester, 95%, Benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate 95%, Benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate, 98%, 98%, 2-Aminomethyl-pyrrolidine-1-carboxylic acid benzyl ester, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
Benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate (CAS 119020-03-0) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate. InChIKey: NQGRCKNDDGCZPV-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate |
| InChIKey | NQGRCKNDDGCZPV-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)OCC2=CC=CC=C2)CN |
Computed by PubChem (NCBI)