cas: 56523-58-1 — see every product listed under this CAS number, including other names
(S)-2-Phenylpyrrolidine hydrochloride 95% (CAS 56523-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104596-100mg |
| cas | 56523-58-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1165.81 Pln | |
| Ambeed | 5g | 4219.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A104596 |
(2S)-2-phenylpyrrolidine;hydrochloride (CAS 56523-58-1) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (2S)-2-phenylpyrrolidine;hydrochloride. InChIKey: QVSABGBFWNYAQG-PPHPATTJSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (2S)-2-phenylpyrrolidine;hydrochloride |
| InChIKey | QVSABGBFWNYAQG-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)