cas: 56523-58-1 — see every product listed under this CAS number, including other names
(S)-2-Phenylpyrrolidine hydrochloride, 95% (CAS 56523-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F449618-100MG |
| cas | 56523-58-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 534.20 Pln | |
| Fluorochem | 1g | 1393.28 Pln | |
| Fluorochem | 5g | 4506.76 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-phenylpyrrolidine;hydrochloride (CAS 56523-58-1) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (2S)-2-phenylpyrrolidine;hydrochloride. InChIKey: QVSABGBFWNYAQG-PPHPATTJSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (2S)-2-phenylpyrrolidine;hydrochloride |
| InChIKey | QVSABGBFWNYAQG-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)