cas: 1956435-50-9 — see every product listed under this CAS number, including other names
(S)-3-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-4-(3-BROMOPHENYL)BUTANOIC ACID, 98% (CAS 1956435-50-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F841854-100MG |
| cas | 1956435-50-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 633.13 Pln | |
| Fluorochem | 5g | 2939.61 Pln | |
| Fluorochem | 10g | 5261.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-4-(3-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1956435-50-9) is a chemical compound with the molecular formula C25H22BrNO4 and a molecular weight of 480.3 g/mol. IUPAC name: (3S)-4-(3-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: DZMCYXYXRITKHK-SFHVURJKSA-N.
| Molecular formula | C25H22BrNO4 |
|---|---|
| Molecular weight | 480.3 g/mol |
| IUPAC name | (3S)-4-(3-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | DZMCYXYXRITKHK-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)Br)CC(=O)O |
Computed by PubChem (NCBI)