CAS 193414-04-9 appears in our catalog under these names: (3S)-3-{((tert-Butoxy)carbonyl)(methyl)amino}butanoic acid, (3S)-3-{[(tert-butoxy)carbonyl](methyl)amino}butanoic acid, 97%, 97%, (S)-3-((tert-Butoxycarbonyl)(methyl)amino)butanoic acid, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 50mg, 250mg, 500mg, 1g, 100mg.
(3S)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 193414-04-9) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (3S)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: XQHMMBUTUOAXHP-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (3S)-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | XQHMMBUTUOAXHP-ZETCQYMHSA-N |
| SMILES | C[C@@H](CC(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)