CAS 112392-65-1 appears in our catalog under these names: methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate, 96%, (R)-Methyl 2-((tert-butoxycarbonyl)amino)butanoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 112392-65-1) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: RFNZPQBRSIZDHQ-SSDOTTSWSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | RFNZPQBRSIZDHQ-SSDOTTSWSA-N |
| SMILES | CC[C@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)