cas: 500770-77-4 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-3-(2-(trifluoromethyl)phenyl)propanoic acid, 95% (CAS 500770-77-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F229991-100MG |
| cas | 500770-77-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 1497.41 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 500770-77-4) is a chemical compound with the molecular formula C15H18F3NO4 and a molecular weight of 333.30 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: DYZRXQICSTZZKP-NSHDSACASA-N.
| Molecular formula | C15H18F3NO4 |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | DYZRXQICSTZZKP-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=CC=C1C(F)(F)F |
Computed by PubChem (NCBI)