cas: 190190-50-2 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-4,4-diphenylbutanoic acid, ≥98%(HPLC), ≥98%(HPLC) (CAS 190190-50-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113EE1-100mg |
| cas | 190190-50-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 500mg | 3112.40 Pln |
| purity | ≥98%(HPLC) |
|---|---|
| delivery time | 3 weeks |
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,4-diphenylbutanoic acid (CAS 190190-50-2) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,4-diphenylbutanoic acid. InChIKey: YLGVWWIOFMUJSK-KRWDZBQOSA-N.
| Molecular formula | C21H25NO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,4-diphenylbutanoic acid |
| InChIKey | YLGVWWIOFMUJSK-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)