CAS 190190-50-2 appears in our catalog under these names: Boc-(s)-3-amino-4,4-diphenyl-butyric acid, 95%, (S)–3–((tert–Butoxycarbonyl)amino)–4,4–diphenylbutanoic acid, (S)-3-((tert-Butoxycarbonyl)amino)-4,4-diphenylbutanoic acid, ≥98%(HPLC), ≥98%(HPLC). Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,4-diphenylbutanoic acid (CAS 190190-50-2) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,4-diphenylbutanoic acid. InChIKey: YLGVWWIOFMUJSK-KRWDZBQOSA-N.
| Molecular formula | C21H25NO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4,4-diphenylbutanoic acid |
| InChIKey | YLGVWWIOFMUJSK-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)