CAS 66617-58-1 appears in our catalog under these names: Boc–Phe–OBzl, Boc-Phe-OBzl, BOC-PHE-OBZL, 97%, 97%, Benzyl (tert-butoxycarbonyl)-L-phenylalaninate, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
Benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 66617-58-1) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: MBGXOZTZHRIZRO-SFHVURJKSA-N.
| Molecular formula | C21H25NO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| InChIKey | MBGXOZTZHRIZRO-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)