cas: 270065-86-6 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-4-(3-cyanophenyl)butanoic acid, 98% (CAS 270065-86-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689850-100MG |
| cas | 270065-86-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 143.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-4-(3-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 270065-86-6) is a chemical compound with the molecular formula C16H20N2O4 and a molecular weight of 304.34 g/mol. IUPAC name: (3S)-4-(3-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: CYGNMSRSGBBZOE-ZDUSSCGKSA-N.
| Molecular formula | C16H20N2O4 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | (3S)-4-(3-cyanophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | CYGNMSRSGBBZOE-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)C#N)CC(=O)O |
Computed by PubChem (NCBI)