cas: 2641451-74-1 — see every product listed under this CAS number, including other names
(S)-3-(4-Bromo-2-thiazolyl)-2-(Boc-amino)propanoic Acid, 98% (CAS 2641451-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch130VZB-100mg |
| cas | 2641451-74-1 |
| size | 100mg |
| availability | 38.57g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 500mg | 242.00 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 957.20 Pln | |
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 25g | 3443.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2641451-74-1) is a chemical compound with the molecular formula C11H15BrN2O4S and a molecular weight of 351.22 g/mol. IUPAC name: (2S)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: LUCLYJDULYUBBG-LURJTMIESA-N.
| Molecular formula | C11H15BrN2O4S |
|---|---|
| Molecular weight | 351.22 g/mol |
| IUPAC name | (2S)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | LUCLYJDULYUBBG-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=NC(=CS1)Br)C(=O)O |
Computed by PubChem (NCBI)