CAS 3034241-62-5 is the registry number for Boc-D-Ala(4-Bromothiazol-2-yl)-OH 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 3034241-62-5) is a chemical compound with the molecular formula C11H15BrN2O4S and a molecular weight of 351.22 g/mol. IUPAC name: (2R)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: LUCLYJDULYUBBG-ZCFIWIBFSA-N.
| Molecular formula | C11H15BrN2O4S |
|---|---|
| Molecular weight | 351.22 g/mol |
| IUPAC name | (2R)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | LUCLYJDULYUBBG-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=NC(=CS1)Br)C(=O)O |
Computed by PubChem (NCBI)