Products 1395284-70-4
CAS 1395284-70-4 is the registry number for Ethyl 2-bromo-5-((tert-butoxycarbonyl)amino)thiazole-4-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-bromo-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate (CAS 1395284-70-4) is a chemical compound with the molecular formula C11H15BrN2O4S and a molecular weight of 351.22 g/mol. IUPAC name: ethyl 2-bromo-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate. InChIKey: OAEALTFDHHWAQZ-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O4S |
|---|---|
| Molecular weight | 351.22 g/mol |
| IUPAC name | ethyl 2-bromo-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylate |
| InChIKey | OAEALTFDHHWAQZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)