cas: 23508-35-2 — see every product listed under this CAS number, including other names
(S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid, 99.77% (CAS 23508-35-2) is a chemical reagent available from Chemat. Available pack sizes: 5 mg, 10mM/1mL, 50 mg, 100 mg, 250 mg, 10 mg, 25 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-136593-5 mg |
| cas | 23508-35-2 |
| size | 5 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 mg | 273.25 Pln | |
| MedChemExpress | 10mM/1mL | 287.18 Pln | |
| MedChemExpress | 50 mg | 691.21 Pln | |
| MedChemExpress | 100 mg | 923.41 Pln | |
| MedChemExpress | 250 mg | 1415.68 Pln | |
| MedChemExpress | 10 mg | 361.49 Pln | |
| MedChemExpress | 25 mg | 528.67 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.77% |
(2S)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid (CAS 23508-35-2) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: (2S)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid. InChIKey: JVGVDSSUAVXRDY-QMMMGPOBSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (2S)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | JVGVDSSUAVXRDY-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)O)O |
Computed by PubChem (NCBI)