Products 2249814-89-7
CAS 2249814-89-7 is the registry number for Hydroxyphenyllactic acid-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2,3,3-trideuterio-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid (CAS 2249814-89-7) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 185.19 g/mol. IUPAC name: 2,3,3-trideuterio-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid. InChIKey: JVGVDSSUAVXRDY-VWTWQGAWSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 185.19 g/mol |
| IUPAC name | 2,3,3-trideuterio-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | JVGVDSSUAVXRDY-VWTWQGAWSA-N |
| SMILES | [2H]C([2H])(C1=CC=C(C=C1)O)C([2H])(C(=O)O)O |
Computed by PubChem (NCBI)