cas: 1369530-77-7 — see every product listed under this CAS number, including other names
(S)-3-(4-bromo-3-fluorophenyl)-5-(hydroxymethyl)oxazolidin-2-one, 95%, 95% (CAS 1369530-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1123LG-100mg |
| cas | 1369530-77-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 923.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(5S)-3-(4-bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS 1369530-77-7) is a chemical compound with the molecular formula C10H9BrFNO3 and a molecular weight of 290.09 g/mol. IUPAC name: (5S)-3-(4-bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one. InChIKey: UGBKYDASQNOIHP-ZETCQYMHSA-N.
| Molecular formula | C10H9BrFNO3 |
|---|---|
| Molecular weight | 290.09 g/mol |
| IUPAC name | (5S)-3-(4-bromo-3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| InChIKey | UGBKYDASQNOIHP-ZETCQYMHSA-N |
| SMILES | C1[C@H](OC(=O)N1C2=CC(=C(C=C2)Br)F)CO |
Computed by PubChem (NCBI)